C14H33N5O4 — CID 173046545
(2R,3R)-N-(1,2-diaminoethyl)-2,3-dihydroxy-4-oxobutanamide;ethane-1,2-diamine;ethene (PubChem CID 173046545) has the molecular formula C14H33N5O4 and a molecular weight of 335.45 g/mol. Its IUPAC name is (2R,3R)-N-(1,2-diaminoethyl)-2,3-dihydroxy-4-oxobutanamide;ethane-1,2-diamine;ethene.
| Compound Name | (2R,3R)-N-(1,2-diaminoethyl)-2,3-dihydroxy-4-oxobutanamide;ethane-1,2-diamine;ethene |
|---|---|
| PubChem CID | 173046545 |
| Molecular Formula | C14H33N5O4 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (2R,3R)-N-(1,2-diaminoethyl)-2,3-dihydroxy-4-oxobutanamide;ethane-1,2-diamine;ethene |
| SMILES | C=C.C=C.C=C.NCC(N)NC(=O)[C@H](O)[C@@H](O)C=O.NCCN |
| InChI | InChI=1S/C6H13N3O4.C2H8N2.3C2H4/c7-1-4(8)9-6(13)5(12)3(11)2-10;3-1-2-4;3*1-2/h2-5,11-12H,1,7-8H2,(H,9,13);1-4H2;3*1-2H2/t3-,4?,5+;;;;/m0..../s1 |
| InChIKey | QRFCXQMNJPPFHC-ZEGWMGRBSA-N |
| XLogP | -2.42 |
| TPSA | 190.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|