C15H31Cl2F3O2Si — CID 173046687
dichloromethane;2,2,2-trifluoroacetic acid;tris(2-methylpropyl)silane (PubChem CID 173046687) has the molecular formula C15H31Cl2F3O2Si and a molecular weight of 399.40 g/mol. Its IUPAC name is dichloromethane;2,2,2-trifluoroacetic acid;tris(2-methylpropyl)silane.
| Compound Name | dichloromethane;2,2,2-trifluoroacetic acid;tris(2-methylpropyl)silane |
|---|---|
| PubChem CID | 173046687 |
| Molecular Formula | C15H31Cl2F3O2Si |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | dichloromethane;2,2,2-trifluoroacetic acid;tris(2-methylpropyl)silane |
| SMILES | CC(C)C[SiH](CC(C)C)CC(C)C.ClCCl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H28Si.C2HF3O2.CH2Cl2/c1-10(2)7-13(8-11(3)4)9-12(5)6;3-2(4,5)1(6)7;2-1-3/h10-13H,7-9H2,1-6H3;(H,6,7);1H2 |
| InChIKey | UZHLLTNTZCZCOL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|