About N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride
N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride (PubChem CID 173046992) has the molecular formula C6H14ClN5O
and a molecular weight of 207.66 g/mol. Its IUPAC name is N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride.
Molecular Properties
| Compound Name | N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride |
| PubChem CID | 173046992 |
| Molecular Formula | C6H14ClN5O |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride |
| SMILES | [Cl-].[H+].[H]/N=C(\N)N=C(N)N1CCOCC1 |
| InChI | InChI=1S/C6H13N5O.ClH/c7-5(8)10-6(9)11-1-3-12-4-2-11;/h1-4H2,(H5,7,8,9,10);1H |
| InChIKey | FXYZDFSNBBOHTA-UHFFFAOYSA-N |
| XLogP | -4.36 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride?
The IUPAC name of N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride (CID 173046992) is N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride.
What is the SMILES notation for N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride?
The canonical SMILES for N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride is [Cl-].[H+].[H]/N=C(\N)N=C(N)N1CCOCC1.
What is the InChIKey of N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride?
The InChIKey is FXYZDFSNBBOHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O.ClH/c7-5(8)10-6(9)11-1-3-12-4-2-11;/h1-4H2,(H5,7,8,9,10);1H.
What are the key properties of N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride?
N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride has a molecular weight of 207.66 g/mol, XLogP of -4.36, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-carbamimidoylmorpholine-4-carboximidamide;hydron;chloride is sourced from PubChem (CID 173046992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).