C25H24F3N3O8S3 — CID 173047514
N-[4-[[3-[(1-methylsulfonylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 173047514) has the molecular formula C25H24F3N3O8S3 and a molecular weight of 647.68 g/mol. Its IUPAC name is N-[4-[[3-[(1-methylsulfonylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[[3-[(1-methylsulfonylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 173047514 |
| Molecular Formula | C25H24F3N3O8S3 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.07 |
| IUPAC Name | N-[4-[[3-[(1-methylsulfonylcyclohexyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenyl]-4-nitro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)C1(CN2C(=O)SC(=Cc3ccc(NS(=O)(=O)c4ccc([N+](=O)[O-])c(C(F)(F)F)c4)cc3)C2=O)CCCCC1 |
| InChI | InChI=1S/C25H24F3N3O8S3/c1-41(36,37)24(11-3-2-4-12-24)15-30-22(32)21(40-23(30)33)13-16-5-7-17(8-6-16)29-42(38,39)18-9-10-20(31(34)35)19(14-18)25(26,27)28/h5-10,13-14,29H,2-4,11-12,15H2,1H3 |
| InChIKey | YAHCDASEFGXVNT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|