C16H22Cl2Si — CID 173048016
bis(4-chloro-2,3,5-trimethylcyclopenta-1,4-dien-1-yl)silane (PubChem CID 173048016) has the molecular formula C16H22Cl2Si and a molecular weight of 313.34 g/mol. Its IUPAC name is bis(4-chloro-2,3,5-trimethylcyclopenta-1,4-dien-1-yl)silane.
| Compound Name | bis(4-chloro-2,3,5-trimethylcyclopenta-1,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173048016 |
| Molecular Formula | C16H22Cl2Si |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | bis(4-chloro-2,3,5-trimethylcyclopenta-1,4-dien-1-yl)silane |
| SMILES | CC1=C(Cl)C(C)C(C)=C1[SiH2]C1=C(C)C(C)C(Cl)=C1C |
| InChI | InChI=1S/C16H22Cl2Si/c1-7-9(3)15(11(5)13(7)17)19-16-10(4)8(2)14(18)12(16)6/h7-8H,19H2,1-6H3 |
| InChIKey | QAUUJXQFUCCKAB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|