C33H31N3O15 — CID 173048051
1,8,14a-trihydroxy-6-hydroxyimino-11-[(4-hydroxyimino-3,5-dimethoxy-6-methyloxan-2-yl)amino]-6a-methoxy-3-methyl-7,9,12,14-tetraoxo-5H-benzo[a]tetracene-2-carboxylic acid (PubChem CID 173048051) has the molecular formula C33H31N3O15 and a molecular weight of 709.62 g/mol. Its IUPAC name is 1,8,14a-trihydroxy-6-hydroxyimino-11-[(4-hydroxyimino-3,5-dimethoxy-6-methyloxan-2-yl)amino]-6a-methoxy-3-methyl-7,9,12,14-tetraoxo-5H-benzo[a]tetracene-2-carboxylic acid.
| Compound Name | 1,8,14a-trihydroxy-6-hydroxyimino-11-[(4-hydroxyimino-3,5-dimethoxy-6-methyloxan-2-yl)amino]-6a-methoxy-3-methyl-7,9,12,14-tetraoxo-5H-benzo[a]tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 173048051 |
| Molecular Formula | C33H31N3O15 |
| Molecular Weight | 709.62 g/mol |
| Exact Mass | 709.18 |
| IUPAC Name | 1,8,14a-trihydroxy-6-hydroxyimino-11-[(4-hydroxyimino-3,5-dimethoxy-6-methyloxan-2-yl)amino]-6a-methoxy-3-methyl-7,9,12,14-tetraoxo-5H-benzo[a]tetracene-2-carboxylic acid |
| SMILES | COC1C(=NO)C(OC)C(NC2=CC(=O)c3c(cc4c(c3O)C(=O)C3(OC)C(=NO)Cc5cc(C)c(C(=O)O)c(O)c5C3(O)C4=O)C2=O)OC1C |
| InChI | InChI=1S/C33H31N3O15/c1-10-6-12-7-17(35-46)33(50-5)29(42)20-14(28(41)32(33,45)21(12)25(40)18(10)31(43)44)8-13-19(24(20)39)16(37)9-15(23(13)38)34-30-27(49-4)22(36-47)26(48-3)11(2)51-30/h6,8-9,11,26-27,30,34,39-40,45-47H,7H2,1-5H3,(H,43,44) |
| InChIKey | LLWNZBQYHPRYDK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 280.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.62 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|