C18H16N4O3 — CID 173048407
N-[(1S)-6-[(7-formyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)oxy]-2,3-dihydro-1H-inden-1-yl]acetamide (PubChem CID 173048407) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[(1S)-6-[(7-formyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)oxy]-2,3-dihydro-1H-inden-1-yl]acetamide.
| Compound Name | N-[(1S)-6-[(7-formyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)oxy]-2,3-dihydro-1H-inden-1-yl]acetamide |
|---|---|
| PubChem CID | 173048407 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-[(1S)-6-[(7-formyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)oxy]-2,3-dihydro-1H-inden-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCc2ccc(Oc3cnc4[nH]cc(C=O)c4n3)cc21 |
| InChI | InChI=1S/C18H16N4O3/c1-10(24)21-15-5-3-11-2-4-13(6-14(11)15)25-16-8-20-18-17(22-16)12(9-23)7-19-18/h2,4,6-9,15H,3,5H2,1H3,(H,19,20)(H,21,24)/t15-/m0/s1 |
| InChIKey | DXZPIQGYEYPULV-HNNXBMFYSA-N |
| XLogP | 2.69 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|