About 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride
1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride (PubChem CID 173048442) has the molecular formula C15H27ClN2
and a molecular weight of 270.85 g/mol. Its IUPAC name is 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride.
Molecular Properties
| Compound Name | 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride |
| PubChem CID | 173048442 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride |
| SMILES | C1CCC(C2=NCCN2C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C15H26N2.ClH/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14;/h13-14H,1-12H2;1H |
| InChIKey | UUIJUXMJLPKADV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride?
The IUPAC name of 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride (CID 173048442) is 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride.
What is the SMILES notation for 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride?
The canonical SMILES for 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride is C1CCC(C2=NCCN2C2CCCCC2)CC1.Cl.
What is the InChIKey of 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride?
The InChIKey is UUIJUXMJLPKADV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2.ClH/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14;/h13-14H,1-12H2;1H.
What are the key properties of 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride?
1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride has a molecular weight of 270.85 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dicyclohexyl-4,5-dihydroimidazole;hydrochloride is sourced from PubChem (CID 173048442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).