C21H24F3N3O6 — CID 173049521
methyl 3-hydroxy-9-[methyl-[(1S)-1-phenylethyl]amino]-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 173049521) has the molecular formula C21H24F3N3O6 and a molecular weight of 471.43 g/mol. Its IUPAC name is methyl 3-hydroxy-9-[methyl-[(1S)-1-phenylethyl]amino]-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 3-hydroxy-9-[methyl-[(1S)-1-phenylethyl]amino]-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173049521 |
| Molecular Formula | C21H24F3N3O6 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | methyl 3-hydroxy-9-[methyl-[(1S)-1-phenylethyl]amino]-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)c1nc2n(c(=O)c1O)CCCC2N(C)[C@@H](C)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O4.C2HF3O2/c1-12(13-8-5-4-6-9-13)21(2)14-10-7-11-22-17(14)20-15(19(25)26-3)16(23)18(22)24;3-2(4,5)1(6)7/h4-6,8-9,12,14,23H,7,10-11H2,1-3H3;(H,6,7)/t12-,14?;/m0./s1 |
| InChIKey | TWJGKTRTUCNCDE-GUDMUQDVSA-N |
| XLogP | 2.90 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |