C6H13NO2 — CID 173049740
(3R,4R,6R)-4-amino-6-methyloxan-3-ol (PubChem CID 173049740) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is (3R,4R,6R)-4-amino-6-methyloxan-3-ol.
| Compound Name | (3R,4R,6R)-4-amino-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 173049740 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (3R,4R,6R)-4-amino-6-methyloxan-3-ol |
| SMILES | C[C@@H]1C[C@@H](N)[C@@H](O)CO1 |
| InChI | InChI=1S/C6H13NO2/c1-4-2-5(7)6(8)3-9-4/h4-6,8H,2-3,7H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | XBUZJOCTNXCXML-PBXRRBTRSA-N |
| XLogP | -0.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |