C45H86N2O5 — CID 173049908
acetic acid;(9Z,29Z)-19-(dimethylamino)-20-(2-hydroxyethylamino)-19-methyloctatriaconta-9,29-diene-18,21-dione (PubChem CID 173049908) has the molecular formula C45H86N2O5 and a molecular weight of 735.19 g/mol. Its IUPAC name is acetic acid;(9Z,29Z)-19-(dimethylamino)-20-(2-hydroxyethylamino)-19-methyloctatriaconta-9,29-diene-18,21-dione.
| Compound Name | acetic acid;(9Z,29Z)-19-(dimethylamino)-20-(2-hydroxyethylamino)-19-methyloctatriaconta-9,29-diene-18,21-dione |
|---|---|
| PubChem CID | 173049908 |
| Molecular Formula | C45H86N2O5 |
| Molecular Weight | 735.19 g/mol |
| Exact Mass | 734.65 |
| IUPAC Name | acetic acid;(9Z,29Z)-19-(dimethylamino)-20-(2-hydroxyethylamino)-19-methyloctatriaconta-9,29-diene-18,21-dione |
| SMILES | CC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)C(NCCO)C(C)(C(=O)CCCCCCC/C=C\CCCCCCCC)N(C)C |
| InChI | InChI=1S/C43H82N2O3.C2H4O2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40(47)42(44-38-39-46)43(3,45(4)5)41(48)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;1-2(3)4/h20-23,42,44,46H,6-19,24-39H2,1-5H3;1H3,(H,3,4)/b22-20-,23-21-; |
| InChIKey | RGJIBKUXADEMSC-LQDDAWAPSA-N |
| XLogP | 11.56 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.19 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|