About 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole
3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole (PubChem CID 173049957) has the molecular formula C11H5BrF6N2
and a molecular weight of 359.07 g/mol. Its IUPAC name is 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole |
| PubChem CID | 173049957 |
| Molecular Formula | C11H5BrF6N2 |
| Molecular Weight | 359.07 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)(F)c1[nH]nc(-c2ccccc2Br)c1C(F)(F)F |
| InChI | InChI=1S/C11H5BrF6N2/c12-6-4-2-1-3-5(6)8-7(10(13,14)15)9(20-19-8)11(16,17)18/h1-4H,(H,19,20) |
| InChIKey | FOJIXZSAIPRTQV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.07 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole?
The IUPAC name of 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole (CID 173049957) is 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole.
What is the SMILES notation for 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole?
The canonical SMILES for 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole is FC(F)(F)c1[nH]nc(-c2ccccc2Br)c1C(F)(F)F.
What is the InChIKey of 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole?
The InChIKey is FOJIXZSAIPRTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5BrF6N2/c12-6-4-2-1-3-5(6)8-7(10(13,14)15)9(20-19-8)11(16,17)18/h1-4H,(H,19,20).
What are the key properties of 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole?
3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole has a molecular weight of 359.07 g/mol, XLogP of 4.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-4,5-bis(trifluoromethyl)-1H-pyrazole is sourced from PubChem (CID 173049957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).