About 5-iminopent-2-ene-1,3-diol
5-iminopent-2-ene-1,3-diol (PubChem CID 173050171) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 5-iminopent-2-ene-1,3-diol.
Molecular Properties
| Compound Name | 5-iminopent-2-ene-1,3-diol |
| PubChem CID | 173050171 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 5-iminopent-2-ene-1,3-diol |
| SMILES | [H]/N=C/CC(O)=CCO |
| InChI | InChI=1S/C5H9NO2/c6-3-1-5(8)2-4-7/h2-3,6-8H,1,4H2/b5-2?,6-3+ |
| InChIKey | FPEISLRHLKUIQM-WUJPMFQDSA-N |
| XLogP | 0.46 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminopent-2-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminopent-2-ene-1,3-diol?
The IUPAC name of 5-iminopent-2-ene-1,3-diol (CID 173050171) is 5-iminopent-2-ene-1,3-diol.
What is the SMILES notation for 5-iminopent-2-ene-1,3-diol?
The canonical SMILES for 5-iminopent-2-ene-1,3-diol is [H]/N=C/CC(O)=CCO.
What is the InChIKey of 5-iminopent-2-ene-1,3-diol?
The InChIKey is FPEISLRHLKUIQM-WUJPMFQDSA-N. The full InChI is InChI=1S/C5H9NO2/c6-3-1-5(8)2-4-7/h2-3,6-8H,1,4H2/b5-2?,6-3+.
What are the key properties of 5-iminopent-2-ene-1,3-diol?
5-iminopent-2-ene-1,3-diol has a molecular weight of 115.13 g/mol, XLogP of 0.46, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminopent-2-ene-1,3-diol is sourced from PubChem (CID 173050171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).