About 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate
2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate (PubChem CID 173050428) has the molecular formula C33H53NO
and a molecular weight of 479.79 g/mol. Its IUPAC name is 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate |
| PubChem CID | 173050428 |
| Molecular Formula | C33H53NO |
| Molecular Weight | 479.79 g/mol |
| Exact Mass | 479.41 |
| IUPAC Name | 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate |
| SMILES | CC1C2CC3CC(C2)CC1(N(C12CC4CC(CC(C4)C1C)C2)C12CC4CC(CC(C4)C1C)C2)C3.O |
| InChI | InChI=1S/C33H51N.H2O/c1-19-28-7-22-4-23(8-28)14-31(19,13-22)34(32-15-24-5-25(16-32)10-29(9-24)20(32)2)33-17-26-6-27(18-33)12-30(11-26)21(33)3;/h19-30H,4-18H2,1-3H3;1H2 |
| InChIKey | IKENZHMXILSUAO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.79 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate?
The IUPAC name of 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate (CID 173050428) is 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate.
What is the SMILES notation for 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate?
The canonical SMILES for 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate is CC1C2CC3CC(C2)CC1(N(C12CC4CC(CC(C4)C1C)C2)C12CC4CC(CC(C4)C1C)C2)C3.O.
What is the InChIKey of 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate?
The InChIKey is IKENZHMXILSUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H51N.H2O/c1-19-28-7-22-4-23(8-28)14-31(19,13-22)34(32-15-24-5-25(16-32)10-29(9-24)20(32)2)33-17-26-6-27(18-33)12-30(11-26)21(33)3;/h19-30H,4-18H2,1-3H3;1H2.
What are the key properties of 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate?
2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate has a molecular weight of 479.79 g/mol, XLogP of 7.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(2-methyl-1-adamantyl)adamantan-1-amine;hydrate is sourced from PubChem (CID 173050428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).