About 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine
1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 173051074) has the molecular formula C16H22F3N
and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 173051074 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | CC1=C(C2CCN(CC3CC3(F)F)CC2)C=C(F)CC1 |
| InChI | InChI=1S/C16H22F3N/c1-11-2-3-14(17)8-15(11)12-4-6-20(7-5-12)10-13-9-16(13,18)19/h8,12-13H,2-7,9-10H2,1H3 |
| InChIKey | FOWOCZFZDUAJDG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine (CID 173051074) is 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine is CC1=C(C2CCN(CC3CC3(F)F)CC2)C=C(F)CC1.
What is the InChIKey of 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is FOWOCZFZDUAJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3N/c1-11-2-3-14(17)8-15(11)12-4-6-20(7-5-12)10-13-9-16(13,18)19/h8,12-13H,2-7,9-10H2,1H3.
What are the key properties of 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine?
1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 285.35 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-difluorocyclopropyl)methyl]-4-(5-fluoro-2-methylcyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 173051074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).