About 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol
2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol (PubChem CID 173051397) has the molecular formula C7H15NO7
and a molecular weight of 225.20 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol.
Molecular Properties
| Compound Name | 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol |
| PubChem CID | 173051397 |
| Molecular Formula | C7H15NO7 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol |
| SMILES | CNCCO.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H6O6.C3H9NO/c5-1(3(7)8)2(6)4(9)10;1-4-2-3-5/h1-2,5-6H,(H,7,8)(H,9,10);4-5H,2-3H2,1H3 |
| InChIKey | DGERBLPBGXNYNW-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol?
The IUPAC name of 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol (CID 173051397) is 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol.
What is the SMILES notation for 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol?
The canonical SMILES for 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol is CNCCO.O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol?
The InChIKey is DGERBLPBGXNYNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O6.C3H9NO/c5-1(3(7)8)2(6)4(9)10;1-4-2-3-5/h1-2,5-6H,(H,7,8)(H,9,10);4-5H,2-3H2,1H3.
What are the key properties of 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol?
2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol has a molecular weight of 225.20 g/mol, XLogP of -2.92, 5 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybutanedioic acid;2-(methylamino)ethanol is sourced from PubChem (CID 173051397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).