C12H5BrF12OS — CID 173051715
1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2-trifluoroethylsulfinyl)benzene (PubChem CID 173051715) has the molecular formula C12H5BrF12OS and a molecular weight of 505.12 g/mol. Its IUPAC name is 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2-trifluoroethylsulfinyl)benzene.
| Compound Name | 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2-trifluoroethylsulfinyl)benzene |
|---|---|
| PubChem CID | 173051715 |
| Molecular Formula | C12H5BrF12OS |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 503.91 |
| IUPAC Name | 1-bromo-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-5-(1,1,2-trifluoroethylsulfinyl)benzene |
| SMILES | O=S(c1cc(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1)C(F)(F)CF |
| InChI | InChI=1S/C12H5BrF12OS/c13-6-1-5(2-7(3-6)27(26)8(15,16)4-14)9(17,11(20,21)22)10(18,19)12(23,24)25/h1-3H,4H2 |
| InChIKey | HVKHUUXPYDTWCQ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|