About azane;nitric acid;phosphoric acid
azane;nitric acid;phosphoric acid (PubChem CID 173051793) has the molecular formula H13N4O7P
and a molecular weight of 212.10 g/mol. Its IUPAC name is azane;nitric acid;phosphoric acid.
Molecular Properties
| Compound Name | azane;nitric acid;phosphoric acid |
| PubChem CID | 173051793 |
| Molecular Formula | H13N4O7P |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | azane;nitric acid;phosphoric acid |
| SMILES | N.N.N.O=P(O)(O)O.O=[N+]([O-])O |
| InChI | InChI=1S/HNO3.3H3N.H3O4P/c2-1(3)4;;;;1-5(2,3)4/h(H,2,3,4);3*1H3;(H3,1,2,3,4) |
| InChIKey | AUKYVRQNWTVGPJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 246.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;nitric acid;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nitric acid;phosphoric acid?
The IUPAC name of azane;nitric acid;phosphoric acid (CID 173051793) is azane;nitric acid;phosphoric acid.
What is the SMILES notation for azane;nitric acid;phosphoric acid?
The canonical SMILES for azane;nitric acid;phosphoric acid is N.N.N.O=P(O)(O)O.O=[N+]([O-])O.
What is the InChIKey of azane;nitric acid;phosphoric acid?
The InChIKey is AUKYVRQNWTVGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/HNO3.3H3N.H3O4P/c2-1(3)4;;;;1-5(2,3)4/h(H,2,3,4);3*1H3;(H3,1,2,3,4).
What are the key properties of azane;nitric acid;phosphoric acid?
azane;nitric acid;phosphoric acid has a molecular weight of 212.10 g/mol, XLogP of -0.79, 0 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nitric acid;phosphoric acid is sourced from PubChem (CID 173051793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).