C24H38O6Si — CID 173051871
5,5-dimethylcyclohexane-1,3-dione;3-(2,2,5-trimethyl-4,6-dioxo-5-silylcyclohexyl)propyl 2-methylprop-2-enoate (PubChem CID 173051871) has the molecular formula C24H38O6Si and a molecular weight of 450.65 g/mol. Its IUPAC name is 5,5-dimethylcyclohexane-1,3-dione;3-(2,2,5-trimethyl-4,6-dioxo-5-silylcyclohexyl)propyl 2-methylprop-2-enoate.
| Compound Name | 5,5-dimethylcyclohexane-1,3-dione;3-(2,2,5-trimethyl-4,6-dioxo-5-silylcyclohexyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173051871 |
| Molecular Formula | C24H38O6Si |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 5,5-dimethylcyclohexane-1,3-dione;3-(2,2,5-trimethyl-4,6-dioxo-5-silylcyclohexyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1C(=O)C(C)([SiH3])C(=O)CC1(C)C.CC1(C)CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C16H26O4Si.C8H12O2/c1-10(2)14(19)20-8-6-7-11-13(18)16(5,21)12(17)9-15(11,3)4;1-8(2)4-6(9)3-7(10)5-8/h11H,1,6-9H2,2-5,21H3;3-5H2,1-2H3 |
| InChIKey | FPOXNBIUBQXXHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|