C14H11Cl2F3 — CID 173052202
1-[(1,5-dichlorocyclohexa-2,4-dien-1-yl)methyl]-2-(trifluoromethyl)benzene (PubChem CID 173052202) has the molecular formula C14H11Cl2F3 and a molecular weight of 307.14 g/mol. Its IUPAC name is 1-[(1,5-dichlorocyclohexa-2,4-dien-1-yl)methyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1-[(1,5-dichlorocyclohexa-2,4-dien-1-yl)methyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 173052202 |
| Molecular Formula | C14H11Cl2F3 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 1-[(1,5-dichlorocyclohexa-2,4-dien-1-yl)methyl]-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccccc1CC1(Cl)C=CC=C(Cl)C1 |
| InChI | InChI=1S/C14H11Cl2F3/c15-11-5-3-7-13(16,9-11)8-10-4-1-2-6-12(10)14(17,18)19/h1-7H,8-9H2 |
| InChIKey | SPFVYIVMYWDUQS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|