About ethyl dec-2-enoate;2-ethyldec-2-enoic acid
ethyl dec-2-enoate;2-ethyldec-2-enoic acid (PubChem CID 173052455) has the molecular formula C24H44O4
and a molecular weight of 396.61 g/mol. Its IUPAC name is ethyl dec-2-enoate;2-ethyldec-2-enoic acid.
Molecular Properties
| Compound Name | ethyl dec-2-enoate;2-ethyldec-2-enoic acid |
| PubChem CID | 173052455 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | ethyl dec-2-enoate;2-ethyldec-2-enoic acid |
| SMILES | CCCCCCCC=C(CC)C(=O)O.CCCCCCCC=CC(=O)OCC |
| InChI | InChI=1S/2C12H22O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2;1-3-5-6-7-8-9-10-11(4-2)12(13)14/h10-11H,3-9H2,1-2H3;10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | IXRYYKQBTJAOLT-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl dec-2-enoate;2-ethyldec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl dec-2-enoate;2-ethyldec-2-enoic acid?
The IUPAC name of ethyl dec-2-enoate;2-ethyldec-2-enoic acid (CID 173052455) is ethyl dec-2-enoate;2-ethyldec-2-enoic acid.
What is the SMILES notation for ethyl dec-2-enoate;2-ethyldec-2-enoic acid?
The canonical SMILES for ethyl dec-2-enoate;2-ethyldec-2-enoic acid is CCCCCCCC=C(CC)C(=O)O.CCCCCCCC=CC(=O)OCC.
What is the InChIKey of ethyl dec-2-enoate;2-ethyldec-2-enoic acid?
The InChIKey is IXRYYKQBTJAOLT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H22O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2;1-3-5-6-7-8-9-10-11(4-2)12(13)14/h10-11H,3-9H2,1-2H3;10H,3-9H2,1-2H3,(H,13,14).
What are the key properties of ethyl dec-2-enoate;2-ethyldec-2-enoic acid?
ethyl dec-2-enoate;2-ethyldec-2-enoic acid has a molecular weight of 396.61 g/mol, XLogP of 7.23, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl dec-2-enoate;2-ethyldec-2-enoic acid is sourced from PubChem (CID 173052455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).