C60H72 — CID 173052655
1,2,3,4-tetrakis(4-tert-butyl-2,5-dimethylphenyl)biphenylene (PubChem CID 173052655) has the molecular formula C60H72 and a molecular weight of 793.24 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(4-tert-butyl-2,5-dimethylphenyl)biphenylene.
| Compound Name | 1,2,3,4-tetrakis(4-tert-butyl-2,5-dimethylphenyl)biphenylene |
|---|---|
| PubChem CID | 173052655 |
| Molecular Formula | C60H72 |
| Molecular Weight | 793.24 g/mol |
| Exact Mass | 792.56 |
| IUPAC Name | 1,2,3,4-tetrakis(4-tert-butyl-2,5-dimethylphenyl)biphenylene |
| SMILES | Cc1cc(C(C)(C)C)c(C)cc1-c1c(-c2cc(C)c(C(C)(C)C)cc2C)c(-c2cc(C)c(C(C)(C)C)cc2C)c2c(c1-c1cc(C)c(C(C)(C)C)cc1C)-c1ccccc1-2 |
| InChI | InChI=1S/C60H72/c1-33-29-47(57(9,10)11)37(5)25-43(33)53-51-41-23-21-22-24-42(41)52(51)54(44-26-38(6)48(30-34(44)2)58(12,13)14)56(46-28-40(8)50(32-36(46)4)60(18,19)20)55(53)45-27-39(7)49(31-35(45)3)59(15,16)17/h21-32H,1-20H3 |
| InChIKey | YPASSDPNAPEINH-UHFFFAOYSA-N |
| XLogP | 17.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.24 |
| LogP ≤ 5 | 17.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |