About bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane
bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane (PubChem CID 173052865) has the molecular formula C20H26N2O5S2
and a molecular weight of 438.57 g/mol. Its IUPAC name is bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane.
Molecular Properties
| Compound Name | bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane |
| PubChem CID | 173052865 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane |
| SMILES | C.COc1ccc(C(=O)C=C(O)c2cccc(C)c2)cc1.NC(=O)S.NC(=O)S |
| InChI | InChI=1S/C17H16O3.2CH3NOS.CH4/c1-12-4-3-5-14(10-12)17(19)11-16(18)13-6-8-15(20-2)9-7-13;2*2-1(3)4;/h3-11,19H,1-2H3;2*(H3,2,3,4);1H4 |
| InChIKey | YXAWHFSVQVSRRU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane?
The IUPAC name of bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane (CID 173052865) is bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane.
What is the SMILES notation for bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane?
The canonical SMILES for bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane is C.COc1ccc(C(=O)C=C(O)c2cccc(C)c2)cc1.NC(=O)S.NC(=O)S.
What is the InChIKey of bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane?
The InChIKey is YXAWHFSVQVSRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3.2CH3NOS.CH4/c1-12-4-3-5-14(10-12)17(19)11-16(18)13-6-8-15(20-2)9-7-13;2*2-1(3)4;/h3-11,19H,1-2H3;2*(H3,2,3,4);1H4.
What are the key properties of bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane?
bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane has a molecular weight of 438.57 g/mol, XLogP of 4.41, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbamothioic S-acid);3-hydroxy-1-(4-methoxyphenyl)-3-(3-methylphenyl)prop-2-en-1-one;methane is sourced from PubChem (CID 173052865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).