About (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine
(3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine (PubChem CID 173053427) has the molecular formula C22H33N
and a molecular weight of 311.51 g/mol. Its IUPAC name is (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine |
| PubChem CID | 173053427 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine |
| SMILES | CC1=CCCC([C@@H](CCN(C(C)C)C(C)C)c2ccccc2)=C1 |
| InChI | InChI=1S/C22H33N/c1-17(2)23(18(3)4)15-14-22(20-11-7-6-8-12-20)21-13-9-10-19(5)16-21/h6-8,10-12,16-18,22H,9,13-15H2,1-5H3/t22-/m0/s1 |
| InChIKey | DORHMLCWGPDRTF-QFIPXVFZSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine?
The IUPAC name of (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine (CID 173053427) is (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine.
What is the SMILES notation for (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine?
The canonical SMILES for (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine is CC1=CCCC([C@@H](CCN(C(C)C)C(C)C)c2ccccc2)=C1.
What is the InChIKey of (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine?
The InChIKey is DORHMLCWGPDRTF-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H33N/c1-17(2)23(18(3)4)15-14-22(20-11-7-6-8-12-20)21-13-9-10-19(5)16-21/h6-8,10-12,16-18,22H,9,13-15H2,1-5H3/t22-/m0/s1.
What are the key properties of (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine?
(3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine has a molecular weight of 311.51 g/mol, XLogP of 5.95, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3-methylcyclohexa-1,3-dien-1-yl)-3-phenyl-N,N-di(propan-2-yl)propan-1-amine is sourced from PubChem (CID 173053427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).