C8H9N3S — CID 173053610
4-methyl-2-(1-methylimidazol-4-yl)-1,3-thiazole (PubChem CID 173053610) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 4-methyl-2-(1-methylimidazol-4-yl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(1-methylimidazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 173053610 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4-methyl-2-(1-methylimidazol-4-yl)-1,3-thiazole |
| SMILES | Cc1csc(-c2cn(C)cn2)n1 |
| InChI | InChI=1S/C8H9N3S/c1-6-4-12-8(10-6)7-3-11(2)5-9-7/h3-5H,1-2H3 |
| InChIKey | NAYGJYZLBUAYTG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |