C27H50 — CID 173053646
4,6,11,14-tetramethyl-8-(3-methylbutyl)-8-prop-1-en-2-ylpentadeca-1,11-diene (PubChem CID 173053646) has the molecular formula C27H50 and a molecular weight of 374.70 g/mol. Its IUPAC name is 4,6,11,14-tetramethyl-8-(3-methylbutyl)-8-prop-1-en-2-ylpentadeca-1,11-diene.
| Compound Name | 4,6,11,14-tetramethyl-8-(3-methylbutyl)-8-prop-1-en-2-ylpentadeca-1,11-diene |
|---|---|
| PubChem CID | 173053646 |
| Molecular Formula | C27H50 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.39 |
| IUPAC Name | 4,6,11,14-tetramethyl-8-(3-methylbutyl)-8-prop-1-en-2-ylpentadeca-1,11-diene |
| SMILES | C=CCC(C)CC(C)CC(CCC(C)=CCC(C)C)(CCC(C)C)C(=C)C |
| InChI | InChI=1S/C27H50/c1-11-12-25(9)19-26(10)20-27(23(6)7,17-15-22(4)5)18-16-24(8)14-13-21(2)3/h11,14,21-22,25-26H,1,6,12-13,15-20H2,2-5,7-10H3 |
| InChIKey | BDIFHZSFYRBHHP-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|