About 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine
4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine (PubChem CID 173053695) has the molecular formula C11H14F3NO
and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine |
| PubChem CID | 173053695 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine |
| SMILES | FC(F)(F)C1=CC(N2CCOCC2)=CCC1 |
| InChI | InChI=1S/C11H14F3NO/c12-11(13,14)9-2-1-3-10(8-9)15-4-6-16-7-5-15/h3,8H,1-2,4-7H2 |
| InChIKey | CRVCEWZUSFAYPI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine?
The IUPAC name of 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine (CID 173053695) is 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine.
What is the SMILES notation for 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine?
The canonical SMILES for 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine is FC(F)(F)C1=CC(N2CCOCC2)=CCC1.
What is the InChIKey of 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine?
The InChIKey is CRVCEWZUSFAYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO/c12-11(13,14)9-2-1-3-10(8-9)15-4-6-16-7-5-15/h3,8H,1-2,4-7H2.
What are the key properties of 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine?
4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine has a molecular weight of 233.23 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]morpholine is sourced from PubChem (CID 173053695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).