C17H15FN2O — CID 173054023
N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-1,4-dihydro-3,1-benzoxazin-2-imine (PubChem CID 173054023) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-1,4-dihydro-3,1-benzoxazin-2-imine.
| Compound Name | N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-1,4-dihydro-3,1-benzoxazin-2-imine |
|---|---|
| PubChem CID | 173054023 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-1,4-dihydro-3,1-benzoxazin-2-imine |
| SMILES | Fc1ccc2c(c1)CCC2/N=C1/Nc2ccccc2CO1 |
| InChI | InChI=1S/C17H15FN2O/c18-13-6-7-14-11(9-13)5-8-16(14)20-17-19-15-4-2-1-3-12(15)10-21-17/h1-4,6-7,9,16H,5,8,10H2,(H,19,20) |
| InChIKey | FDBCCKDCXKCXNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|