C8H18LiN — CID 173054121
lithium;hydride;2,2,5,5-tetramethylpyrrolidine (PubChem CID 173054121) has the molecular formula C8H18LiN and a molecular weight of 135.18 g/mol. Its IUPAC name is lithium;hydride;2,2,5,5-tetramethylpyrrolidine.
| Compound Name | lithium;hydride;2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 173054121 |
| Molecular Formula | C8H18LiN |
| Molecular Weight | 135.18 g/mol |
| Exact Mass | 135.16 |
| IUPAC Name | lithium;hydride;2,2,5,5-tetramethylpyrrolidine |
| SMILES | CC1(C)CCC(C)(C)N1.[H-].[Li+] |
| InChI | InChI=1S/C8H17N.Li.H/c1-7(2)5-6-8(3,4)9-7;;/h9H,5-6H2,1-4H3;;/q;+1;-1 |
| InChIKey | NPLMHJJFSXMXEA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.18 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |