C18H6BrF12NS — CID 173054750
4-[2-bromo-6-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile (PubChem CID 173054750) has the molecular formula C18H6BrF12NS and a molecular weight of 576.20 g/mol. Its IUPAC name is 4-[2-bromo-6-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile.
| Compound Name | 4-[2-bromo-6-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 173054750 |
| Molecular Formula | C18H6BrF12NS |
| Molecular Weight | 576.20 g/mol |
| Exact Mass | 574.92 |
| IUPAC Name | 4-[2-bromo-6-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(Br)cc(SC(F)(F)F)cc2C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H6BrF12NS/c19-12-6-10(33-18(29,30)31)5-11(13(12)9-3-1-8(7-32)2-4-9)14(20,16(23,24)25)15(21,22)17(26,27)28/h1-6H |
| InChIKey | YSKDRDPROGORRO-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.20 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|