C16H11ClF7N — CID 173054784
2-chloro-4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-dimethylphenyl]pyridine (PubChem CID 173054784) has the molecular formula C16H11ClF7N and a molecular weight of 385.71 g/mol. Its IUPAC name is 2-chloro-4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-dimethylphenyl]pyridine.
| Compound Name | 2-chloro-4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-dimethylphenyl]pyridine |
|---|---|
| PubChem CID | 173054784 |
| Molecular Formula | C16H11ClF7N |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-chloro-4-[2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4,6-dimethylphenyl]pyridine |
| SMILES | Cc1cc(C)c(-c2ccnc(Cl)c2)c(C(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF7N/c1-8-5-9(2)13(10-3-4-25-12(17)7-10)11(6-8)14(18,15(19,20)21)16(22,23)24/h3-7H,1-2H3 |
| InChIKey | FRLVTFAYSBZHEZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|