C17H6BrF10NS — CID 173054827
4-[2-bromo-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile (PubChem CID 173054827) has the molecular formula C17H6BrF10NS and a molecular weight of 526.19 g/mol. Its IUPAC name is 4-[2-bromo-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile.
| Compound Name | 4-[2-bromo-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 173054827 |
| Molecular Formula | C17H6BrF10NS |
| Molecular Weight | 526.19 g/mol |
| Exact Mass | 524.92 |
| IUPAC Name | 4-[2-bromo-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-(trifluoromethylsulfanyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(Br)cc(SC(F)(F)F)cc2C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H6BrF10NS/c18-12-6-10(30-17(26,27)28)5-11(14(19,15(20,21)22)16(23,24)25)13(12)9-3-1-8(7-29)2-4-9/h1-6H |
| InChIKey | OKAUPEPEEXGQBO-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.19 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |