About but-2-enedioic acid;bis(pyridine)
but-2-enedioic acid;bis(pyridine) (PubChem CID 173055227) has the molecular formula C14H14N2O4
and a molecular weight of 274.28 g/mol. Its IUPAC name is but-2-enedioic acid;bis(pyridine).
Molecular Properties
| Compound Name | but-2-enedioic acid;bis(pyridine) |
| PubChem CID | 173055227 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | but-2-enedioic acid;bis(pyridine) |
| SMILES | O=C(O)C=CC(=O)O.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/2C5H5N.C4H4O4/c2*1-2-4-6-5-3-1;5-3(6)1-2-4(7)8/h2*1-5H;1-2H,(H,5,6)(H,7,8) |
| InChIKey | CIXMBWIEWDRNON-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;bis(pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;bis(pyridine)?
The IUPAC name of but-2-enedioic acid;bis(pyridine) (CID 173055227) is but-2-enedioic acid;bis(pyridine).
What is the SMILES notation for but-2-enedioic acid;bis(pyridine)?
The canonical SMILES for but-2-enedioic acid;bis(pyridine) is O=C(O)C=CC(=O)O.c1ccncc1.c1ccncc1.
What is the InChIKey of but-2-enedioic acid;bis(pyridine)?
The InChIKey is CIXMBWIEWDRNON-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5N.C4H4O4/c2*1-2-4-6-5-3-1;5-3(6)1-2-4(7)8/h2*1-5H;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;bis(pyridine)?
but-2-enedioic acid;bis(pyridine) has a molecular weight of 274.28 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;bis(pyridine) is sourced from PubChem (CID 173055227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).