C4H6MgN2O3 — CID 173055319
magnesium;1,3-diazinane-2,4,6-trione;hydride (PubChem CID 173055319) has the molecular formula C4H6MgN2O3 and a molecular weight of 154.41 g/mol. Its IUPAC name is magnesium;1,3-diazinane-2,4,6-trione;hydride.
| Compound Name | magnesium;1,3-diazinane-2,4,6-trione;hydride |
|---|---|
| PubChem CID | 173055319 |
| Molecular Formula | C4H6MgN2O3 |
| Molecular Weight | 154.41 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | magnesium;1,3-diazinane-2,4,6-trione;hydride |
| SMILES | O=C1CC(=O)NC(=O)N1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C4H4N2O3.Mg.2H/c7-2-1-3(8)6-4(9)5-2;;;/h1H2,(H2,5,6,7,8,9);;;/q;+2;2*-1 |
| InChIKey | DHUPWSGBXJIDGG-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.41 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|