About (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate
(2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate (PubChem CID 173055691) has the molecular formula C13H15IO4
and a molecular weight of 362.16 g/mol. Its IUPAC name is (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate.
Molecular Properties
| Compound Name | (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate |
| PubChem CID | 173055691 |
| Molecular Formula | C13H15IO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate |
| SMILES | CC(C)(CC(=O)OCc1ccccc1I)OC=O |
| InChI | InChI=1S/C13H15IO4/c1-13(2,18-9-15)7-12(16)17-8-10-5-3-4-6-11(10)14/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | WQZCCDCFSLTUCJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate?
The IUPAC name of (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate (CID 173055691) is (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate.
What is the SMILES notation for (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate?
The canonical SMILES for (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate is CC(C)(CC(=O)OCc1ccccc1I)OC=O.
What is the InChIKey of (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate?
The InChIKey is WQZCCDCFSLTUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15IO4/c1-13(2,18-9-15)7-12(16)17-8-10-5-3-4-6-11(10)14/h3-6,9H,7-8H2,1-2H3.
What are the key properties of (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate?
(2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate has a molecular weight of 362.16 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodophenyl)methyl 3-formyloxy-3-methylbutanoate is sourced from PubChem (CID 173055691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).