About 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene
4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene (PubChem CID 173055754) has the molecular formula C9H13FS
and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 173055754 |
| Molecular Formula | C9H13FS |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene |
| SMILES | CSC1=C(C)C=C(F)CC1C |
| InChI | InChI=1S/C9H13FS/c1-6-4-8(10)5-7(2)9(6)11-3/h4,7H,5H2,1-3H3 |
| InChIKey | GZLHXZHWWLEXTL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene (CID 173055754) is 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene is CSC1=C(C)C=C(F)CC1C.
What is the InChIKey of 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
The InChIKey is GZLHXZHWWLEXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FS/c1-6-4-8(10)5-7(2)9(6)11-3/h4,7H,5H2,1-3H3.
What are the key properties of 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene?
4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene has a molecular weight of 172.27 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,6-dimethyl-1-methylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 173055754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).