About 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene
3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene (PubChem CID 173055891) has the molecular formula C9H9F5O
and a molecular weight of 228.16 g/mol. Its IUPAC name is 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene |
| PubChem CID | 173055891 |
| Molecular Formula | C9H9F5O |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene |
| SMILES | CC1=CC(OC(F)F)(C(F)(F)F)C=CC1 |
| InChI | InChI=1S/C9H9F5O/c1-6-3-2-4-8(5-6,9(12,13)14)15-7(10)11/h2,4-5,7H,3H2,1H3 |
| InChIKey | VYVZDZRPBKFMLO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene?
The IUPAC name of 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene (CID 173055891) is 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene.
What is the SMILES notation for 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene?
The canonical SMILES for 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene is CC1=CC(OC(F)F)(C(F)(F)F)C=CC1.
What is the InChIKey of 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene?
The InChIKey is VYVZDZRPBKFMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F5O/c1-6-3-2-4-8(5-6,9(12,13)14)15-7(10)11/h2,4-5,7H,3H2,1H3.
What are the key properties of 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene?
3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene has a molecular weight of 228.16 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)cyclohexa-1,4-diene is sourced from PubChem (CID 173055891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).