About 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene
1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene (PubChem CID 173055962) has the molecular formula C10H14F2S
and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 173055962 |
| Molecular Formula | C10H14F2S |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene |
| SMILES | CSC1C(C(F)F)=CC=CC1(C)C |
| InChI | InChI=1S/C10H14F2S/c1-10(2)6-4-5-7(9(11)12)8(10)13-3/h4-6,8-9H,1-3H3 |
| InChIKey | RQWZPSZAZOOHIS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene (CID 173055962) is 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene is CSC1C(C(F)F)=CC=CC1(C)C.
What is the InChIKey of 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene?
The InChIKey is RQWZPSZAZOOHIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2S/c1-10(2)6-4-5-7(9(11)12)8(10)13-3/h4-6,8-9H,1-3H3.
What are the key properties of 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene?
1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene has a molecular weight of 204.28 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-5,5-dimethyl-6-methylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 173055962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).