C28H33N3O12S — CID 173056124
[1,4-bis[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy]-4-oxobutylidene]sulfamic acid (PubChem CID 173056124) has the molecular formula C28H33N3O12S and a molecular weight of 635.65 g/mol. Its IUPAC name is [1,4-bis[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy]-4-oxobutylidene]sulfamic acid.
| Compound Name | [1,4-bis[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy]-4-oxobutylidene]sulfamic acid |
|---|---|
| PubChem CID | 173056124 |
| Molecular Formula | C28H33N3O12S |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | [1,4-bis[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]oxy]-4-oxobutylidene]sulfamic acid |
| SMILES | O=C(CCC(=NS(=O)(=O)O)OC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)OC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C28H33N3O12S/c32-22-10-11-23(33)30(22)15-17-1-5-19(6-2-17)27(37)42-21(29-44(39,40)41)9-14-26(36)43-28(38)20-7-3-18(4-8-20)16-31-24(34)12-13-25(31)35/h10-13,17-20H,1-9,14-16H2,(H,39,40,41) |
| InChIKey | MYIDDEOKJASCIR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|