bis(dihydroxy(oxo)phosphanium);sulfuric acid

H6O10P2S+2 — CID 173056581

IUPACbis(dihydroxy(oxo)phosphanium);sulfuric acid
SMILESO=S(=O)(O)O.O=[P+](O)O.O=[P+](O)O
InChIInChI=1S/H2O4S.2HO3P/c1-5(2,3)4;2*1-4(2)3/h(H2,1,2,3,4);2*(H-,1,2,3)/p+2
InChIKeyNNYDWNQGZADUMZ-UHFFFAOYSA-P
MW260.05 g/mol
LogP-1.40
Rot. Bonds

About bis(dihydroxy(oxo)phosphanium);sulfuric acid

bis(dihydroxy(oxo)phosphanium);sulfuric acid (PubChem CID 173056581) has the molecular formula H6O10P2S+2 and a molecular weight of 260.05 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);sulfuric acid.

Molecular Properties

Compound Namebis(dihydroxy(oxo)phosphanium);sulfuric acid
PubChem CID173056581
Molecular FormulaH6O10P2S+2
Molecular Weight260.05 g/mol
Exact Mass259.91
IUPAC Namebis(dihydroxy(oxo)phosphanium);sulfuric acid
SMILESO=S(=O)(O)O.O=[P+](O)O.O=[P+](O)O
InChIInChI=1S/H2O4S.2HO3P/c1-5(2,3)4;2*1-4(2)3/h(H2,1,2,3,4);2*(H-,1,2,3)/p+2
InChIKeyNNYDWNQGZADUMZ-UHFFFAOYSA-P
XLogP-1.40
TPSA189.66 Ų
H-Bond Donors6
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500260.05
LogP ≤ 5-1.40
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze bis(dihydroxy(oxo)phosphanium);sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

calcium;dihydroxy(oxo)phosphanium;hydride;sulfuric acid
CID 173175624
hydroxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;sulfuric acid
CID 158188291
dihydroxy(oxo)phosphanium;sulfuric acid;tris(triethylphosphane)
CID 175042860
sodium;hydride;phosphenous acid;sulfuric acid
CID 174935667
dihydroxy(oxo)phosphanium;dihydrochloride
CID 172680217
alumane;sulfuric acid
CID 173042837
sulfuric acid;titanium
CID 22253908
CID 173398648
CID 173398648
sulfuric acid;zinc
CID 173312320
cerium;sulfuric acid
CID 45051640
bismuthane;sulfuric acid
CID 174861750
(barium(2+));sulfuric acid
CID 173434226

Frequently Asked Questions

What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);sulfuric acid?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);sulfuric acid (CID 173056581) is bis(dihydroxy(oxo)phosphanium);sulfuric acid.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);sulfuric acid?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);sulfuric acid is O=S(=O)(O)O.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);sulfuric acid?
The InChIKey is NNYDWNQGZADUMZ-UHFFFAOYSA-P. The full InChI is InChI=1S/H2O4S.2HO3P/c1-5(2,3)4;2*1-4(2)3/h(H2,1,2,3,4);2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);sulfuric acid?
bis(dihydroxy(oxo)phosphanium);sulfuric acid has a molecular weight of 260.05 g/mol, XLogP of -1.40, 0 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);sulfuric acid is sourced from PubChem (CID 173056581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).