About 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene
5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene (PubChem CID 173056594) has the molecular formula C22H24
and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene.
Molecular Properties
| Compound Name | 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene |
| PubChem CID | 173056594 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene |
| SMILES | C=CC1(C)C=CC=C(C)C1.C=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10.C10H14/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-4-10(3)7-5-6-9(2)8-10/h2-9H,1H2;4-7H,1,8H2,2-3H3 |
| InChIKey | QTKYFLURSUGMPX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene?
The IUPAC name of 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene (CID 173056594) is 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene.
What is the SMILES notation for 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene?
The canonical SMILES for 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene is C=CC1(C)C=CC=C(C)C1.C=Cc1cccc2ccccc12.
What is the InChIKey of 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene?
The InChIKey is QTKYFLURSUGMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H14/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-4-10(3)7-5-6-9(2)8-10/h2-9H,1H2;4-7H,1,8H2,2-3H3.
What are the key properties of 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene?
5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene has a molecular weight of 288.43 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,5-dimethylcyclohexa-1,3-diene;1-ethenylnaphthalene is sourced from PubChem (CID 173056594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).