About (2-amino-1,2-dihydropyridin-3-yl)methanol
(2-amino-1,2-dihydropyridin-3-yl)methanol (PubChem CID 173058001) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is (2-amino-1,2-dihydropyridin-3-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-1,2-dihydropyridin-3-yl)methanol |
| PubChem CID | 173058001 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (2-amino-1,2-dihydropyridin-3-yl)methanol |
| SMILES | NC1NC=CC=C1CO |
| InChI | InChI=1S/C6H10N2O/c7-6-5(4-9)2-1-3-8-6/h1-3,6,8-9H,4,7H2 |
| InChIKey | KUBYEGDJCVPORG-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-1,2-dihydropyridin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,2-dihydropyridin-3-yl)methanol?
The IUPAC name of (2-amino-1,2-dihydropyridin-3-yl)methanol (CID 173058001) is (2-amino-1,2-dihydropyridin-3-yl)methanol.
What is the SMILES notation for (2-amino-1,2-dihydropyridin-3-yl)methanol?
The canonical SMILES for (2-amino-1,2-dihydropyridin-3-yl)methanol is NC1NC=CC=C1CO.
What is the InChIKey of (2-amino-1,2-dihydropyridin-3-yl)methanol?
The InChIKey is KUBYEGDJCVPORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c7-6-5(4-9)2-1-3-8-6/h1-3,6,8-9H,4,7H2.
What are the key properties of (2-amino-1,2-dihydropyridin-3-yl)methanol?
(2-amino-1,2-dihydropyridin-3-yl)methanol has a molecular weight of 126.16 g/mol, XLogP of -0.69, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,2-dihydropyridin-3-yl)methanol is sourced from PubChem (CID 173058001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).