About 2-ethyl-3-propoxy-1,2-dihydropyridine
2-ethyl-3-propoxy-1,2-dihydropyridine (PubChem CID 173058048) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-ethyl-3-propoxy-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-ethyl-3-propoxy-1,2-dihydropyridine |
| PubChem CID | 173058048 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-ethyl-3-propoxy-1,2-dihydropyridine |
| SMILES | CCCOC1=CC=CNC1CC |
| InChI | InChI=1S/C10H17NO/c1-3-8-12-10-6-5-7-11-9(10)4-2/h5-7,9,11H,3-4,8H2,1-2H3 |
| InChIKey | UFLZQJRPOLXNKE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3-propoxy-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-propoxy-1,2-dihydropyridine?
The IUPAC name of 2-ethyl-3-propoxy-1,2-dihydropyridine (CID 173058048) is 2-ethyl-3-propoxy-1,2-dihydropyridine.
What is the SMILES notation for 2-ethyl-3-propoxy-1,2-dihydropyridine?
The canonical SMILES for 2-ethyl-3-propoxy-1,2-dihydropyridine is CCCOC1=CC=CNC1CC.
What is the InChIKey of 2-ethyl-3-propoxy-1,2-dihydropyridine?
The InChIKey is UFLZQJRPOLXNKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-8-12-10-6-5-7-11-9(10)4-2/h5-7,9,11H,3-4,8H2,1-2H3.
What are the key properties of 2-ethyl-3-propoxy-1,2-dihydropyridine?
2-ethyl-3-propoxy-1,2-dihydropyridine has a molecular weight of 167.25 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-propoxy-1,2-dihydropyridine is sourced from PubChem (CID 173058048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).