About 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine
2-fluoro-N-methyl-1,2-dihydropyridin-3-amine (PubChem CID 173058061) has the molecular formula C6H9FN2
and a molecular weight of 128.15 g/mol. Its IUPAC name is 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine |
| PubChem CID | 173058061 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine |
| SMILES | CNC1=CC=CNC1F |
| InChI | InChI=1S/C6H9FN2/c1-8-5-3-2-4-9-6(5)7/h2-4,6,8-9H,1H3 |
| InChIKey | FQWVCJBCPXGOJZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine?
The IUPAC name of 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine (CID 173058061) is 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine.
What is the SMILES notation for 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine?
The canonical SMILES for 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine is CNC1=CC=CNC1F.
What is the InChIKey of 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine?
The InChIKey is FQWVCJBCPXGOJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN2/c1-8-5-3-2-4-9-6(5)7/h2-4,6,8-9H,1H3.
What are the key properties of 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine?
2-fluoro-N-methyl-1,2-dihydropyridin-3-amine has a molecular weight of 128.15 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-methyl-1,2-dihydropyridin-3-amine is sourced from PubChem (CID 173058061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).