About N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine
N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine (PubChem CID 173058126) has the molecular formula C7H11FN2
and a molecular weight of 142.18 g/mol. Its IUPAC name is N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine |
| PubChem CID | 173058126 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine |
| SMILES | CCNC1=CC=CNC1F |
| InChI | InChI=1S/C7H11FN2/c1-2-9-6-4-3-5-10-7(6)8/h3-5,7,9-10H,2H2,1H3 |
| InChIKey | PWOQTLWFTDAMRX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine?
The IUPAC name of N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine (CID 173058126) is N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine.
What is the SMILES notation for N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine?
The canonical SMILES for N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine is CCNC1=CC=CNC1F.
What is the InChIKey of N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine?
The InChIKey is PWOQTLWFTDAMRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FN2/c1-2-9-6-4-3-5-10-7(6)8/h3-5,7,9-10H,2H2,1H3.
What are the key properties of N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine?
N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine has a molecular weight of 142.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-fluoro-1,2-dihydropyridin-3-amine is sourced from PubChem (CID 173058126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).