C21H18Cl3NO2 — CID 173058516
5-[2-(3,4,5-trichlorophenoxy)piperidin-3-yl]naphthalen-2-ol (PubChem CID 173058516) has the molecular formula C21H18Cl3NO2 and a molecular weight of 422.74 g/mol. Its IUPAC name is 5-[2-(3,4,5-trichlorophenoxy)piperidin-3-yl]naphthalen-2-ol.
| Compound Name | 5-[2-(3,4,5-trichlorophenoxy)piperidin-3-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 173058516 |
| Molecular Formula | C21H18Cl3NO2 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 5-[2-(3,4,5-trichlorophenoxy)piperidin-3-yl]naphthalen-2-ol |
| SMILES | Oc1ccc2c(C3CCCNC3Oc3cc(Cl)c(Cl)c(Cl)c3)cccc2c1 |
| InChI | InChI=1S/C21H18Cl3NO2/c22-18-10-14(11-19(23)20(18)24)27-21-17(5-2-8-25-21)16-4-1-3-12-9-13(26)6-7-15(12)16/h1,3-4,6-7,9-11,17,21,25-26H,2,5,8H2 |
| InChIKey | FAAOMILEKNZWFE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|