C14H16O7 — CID 173058524
trimethyl 2-methoxy-4-methylbenzene-1,3,5-tricarboxylate (PubChem CID 173058524) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is trimethyl 2-methoxy-4-methylbenzene-1,3,5-tricarboxylate.
| Compound Name | trimethyl 2-methoxy-4-methylbenzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 173058524 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | trimethyl 2-methoxy-4-methylbenzene-1,3,5-tricarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c(OC)c(C(=O)OC)c1C |
| InChI | InChI=1S/C14H16O7/c1-7-8(12(15)19-3)6-9(13(16)20-4)11(18-2)10(7)14(17)21-5/h6H,1-5H3 |
| InChIKey | ZAUITLOGCYHVNB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|