About N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine
N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 173059001) has the molecular formula C6H15ClN2Si
and a molecular weight of 178.74 g/mol. Its IUPAC name is N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 173059001 |
| Molecular Formula | C6H15ClN2Si |
| Molecular Weight | 178.74 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNC=C([SiH3])Cl |
| InChI | InChI=1S/C6H15ClN2Si/c1-9(2)4-3-8-5-6(7)10/h5,8H,3-4H2,1-2,10H3 |
| InChIKey | SWFVSVGOQQROFS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.74 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine (CID 173059001) is N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine is CN(C)CCNC=C([SiH3])Cl.
What is the InChIKey of N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is SWFVSVGOQQROFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15ClN2Si/c1-9(2)4-3-8-5-6(7)10/h5,8H,3-4H2,1-2,10H3.
What are the key properties of N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine?
N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 178.74 g/mol, XLogP of -0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-2-silylethenyl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 173059001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).