C18H12F10 — CID 173059515
2-(4-fluorophenyl)-1,5-dimethyl-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene (PubChem CID 173059515) has the molecular formula C18H12F10 and a molecular weight of 418.27 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,5-dimethyl-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene.
| Compound Name | 2-(4-fluorophenyl)-1,5-dimethyl-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
|---|---|
| PubChem CID | 173059515 |
| Molecular Formula | C18H12F10 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-(4-fluorophenyl)-1,5-dimethyl-3-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)benzene |
| SMILES | Cc1cc(C)c(-c2ccc(F)cc2)c(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F10/c1-9-7-10(2)14(11-3-5-12(19)6-4-11)13(8-9)15(20,17(23,24)25)16(21,22)18(26,27)28/h3-8H,1-2H3 |
| InChIKey | XMIYQLCZKOBMNN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|