C15H8Br2ClF7O2S — CID 173059684
1,5-dibromo-3-(2-chlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)cyclohexa-1,4-diene (PubChem CID 173059684) has the molecular formula C15H8Br2ClF7O2S and a molecular weight of 580.54 g/mol. Its IUPAC name is 1,5-dibromo-3-(2-chlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)cyclohexa-1,4-diene.
| Compound Name | 1,5-dibromo-3-(2-chlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 173059684 |
| Molecular Formula | C15H8Br2ClF7O2S |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 577.82 |
| IUPAC Name | 1,5-dibromo-3-(2-chlorophenyl)-3-(1,1,2,2,3,3,3-heptafluoropropylsulfonyl)cyclohexa-1,4-diene |
| SMILES | O=S(=O)(C1(c2ccccc2Cl)C=C(Br)CC(Br)=C1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H8Br2ClF7O2S/c16-8-5-9(17)7-12(6-8,10-3-1-2-4-11(10)18)28(26,27)15(24,25)13(19,20)14(21,22)23/h1-4,6-7H,5H2 |
| InChIKey | XHSHVYQTOBSCTI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|